C16H19N3O — CID 25180239
1-[(1R,4R)-2,5-diazabicyclo[2.2.2]octan-2-yl]-7-methoxyisoquinoline (PubChem CID 25180239) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 1-[(1R,4R)-2,5-diazabicyclo[2.2.2]octan-2-yl]-7-methoxyisoquinoline.
| Compound Name | 1-[(1R,4R)-2,5-diazabicyclo[2.2.2]octan-2-yl]-7-methoxyisoquinoline |
|---|---|
| PubChem CID | 25180239 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1-[(1R,4R)-2,5-diazabicyclo[2.2.2]octan-2-yl]-7-methoxyisoquinoline |
| SMILES | COc1ccc2ccnc(N3C[C@H]4CC[C@@H]3CN4)c2c1 |
| InChI | InChI=1S/C16H19N3O/c1-20-14-5-2-11-6-7-17-16(15(11)8-14)19-10-12-3-4-13(19)9-18-12/h2,5-8,12-13,18H,3-4,9-10H2,1H3/t12-,13-/m1/s1 |
| InChIKey | NFCKAGVOTZBYSW-CHWSQXEVSA-N |
| XLogP | 2.18 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |