About (2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one
(2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one (PubChem CID 25180822) has the molecular formula C21H23NO3
and a molecular weight of 337.42 g/mol. Its IUPAC name is (2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one.
Molecular Properties
| Compound Name | (2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one |
| PubChem CID | 25180822 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one |
| SMILES | O=C1CCN[C@H]([C@H]2CCOC(c3ccccc3)(c3ccccc3)O2)C1 |
| InChI | InChI=1S/C21H23NO3/c23-18-11-13-22-19(15-18)20-12-14-24-21(25-20,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,19-20,22H,11-15H2/t19-,20+/m0/s1 |
| InChIKey | FFQQZTLYPNJTFJ-VQTJNVASSA-N |
| XLogP | 3.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one?
The IUPAC name of (2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one (CID 25180822) is (2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one.
What is the SMILES notation for (2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one?
The canonical SMILES for (2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one is O=C1CCN[C@H]([C@H]2CCOC(c3ccccc3)(c3ccccc3)O2)C1.
What is the InChIKey of (2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one?
The InChIKey is FFQQZTLYPNJTFJ-VQTJNVASSA-N. The full InChI is InChI=1S/C21H23NO3/c23-18-11-13-22-19(15-18)20-12-14-24-21(25-20,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,19-20,22H,11-15H2/t19-,20+/m0/s1.
What are the key properties of (2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one?
(2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one has a molecular weight of 337.42 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]piperidin-4-one is sourced from PubChem (CID 25180822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).