About 4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide
4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide (PubChem CID 25181419) has the molecular formula C22H27Cl2N3O2
and a molecular weight of 436.38 g/mol. Its IUPAC name is 4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide |
| PubChem CID | 25181419 |
| Molecular Formula | C22H27Cl2N3O2 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide |
| SMILES | CC(C)(C)c1cc(Nc2ccc(Cl)cc2Cl)ncc1C(=O)NCC1CCOCC1 |
| InChI | InChI=1S/C22H27Cl2N3O2/c1-22(2,3)17-11-20(27-19-5-4-15(23)10-18(19)24)25-13-16(17)21(28)26-12-14-6-8-29-9-7-14/h4-5,10-11,13-14H,6-9,12H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | LIKKKFAHHSRGPP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide?
The IUPAC name of 4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide (CID 25181419) is 4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide.
What is the SMILES notation for 4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide?
The canonical SMILES for 4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide is CC(C)(C)c1cc(Nc2ccc(Cl)cc2Cl)ncc1C(=O)NCC1CCOCC1.
What is the InChIKey of 4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide?
The InChIKey is LIKKKFAHHSRGPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27Cl2N3O2/c1-22(2,3)17-11-20(27-19-5-4-15(23)10-18(19)24)25-13-16(17)21(28)26-12-14-6-8-29-9-7-14/h4-5,10-11,13-14H,6-9,12H2,1-3H3,(H,25,27)(H,26,28).
What are the key properties of 4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide?
4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide has a molecular weight of 436.38 g/mol, XLogP of 5.59, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-6-(2,4-dichloroanilino)-N-(oxan-4-ylmethyl)pyridine-3-carboxamide is sourced from PubChem (CID 25181419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).