C30H54N4O4 — CID 25181928
(1S,3R,6S,9R,12R,18S)-6-cyclohexyl-3,8,9-trimethyl-12-(2-methylpropyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosane-7,10,13-trione (PubChem CID 25181928) has the molecular formula C30H54N4O4 and a molecular weight of 534.79 g/mol. Its IUPAC name is (1S,3R,6S,9R,12R,18S)-6-cyclohexyl-3,8,9-trimethyl-12-(2-methylpropyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosane-7,10,13-trione.
| Compound Name | (1S,3R,6S,9R,12R,18S)-6-cyclohexyl-3,8,9-trimethyl-12-(2-methylpropyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosane-7,10,13-trione |
|---|---|
| PubChem CID | 25181928 |
| Molecular Formula | C30H54N4O4 |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.41 |
| IUPAC Name | (1S,3R,6S,9R,12R,18S)-6-cyclohexyl-3,8,9-trimethyl-12-(2-methylpropyl)-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosane-7,10,13-trione |
| SMILES | CC(C)C[C@H]1NC(=O)[C@@H](C)N(C)C(=O)[C@H](C2CCCCC2)NC[C@@H](C)O[C@H]2CCCC[C@H]2CCCNC1=O |
| InChI | InChI=1S/C30H54N4O4/c1-20(2)18-25-29(36)31-17-11-15-23-12-9-10-16-26(23)38-21(3)19-32-27(24-13-7-6-8-14-24)30(37)34(5)22(4)28(35)33-25/h20-27,32H,6-19H2,1-5H3,(H,31,36)(H,33,35)/t21-,22-,23+,25-,26+,27+/m1/s1 |
| InChIKey | HYRRCPBTDCXXHL-MREPLPOYSA-N |
| XLogP | 3.78 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |