C21H19N5O2S — CID 25182020
N-[6-[2-(3-pyridin-3-ylpropoxy)pyrimidin-4-yl]-1,3-benzothiazol-2-yl]acetamide (PubChem CID 25182020) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[6-[2-(3-pyridin-3-ylpropoxy)pyrimidin-4-yl]-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[6-[2-(3-pyridin-3-ylpropoxy)pyrimidin-4-yl]-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 25182020 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[6-[2-(3-pyridin-3-ylpropoxy)pyrimidin-4-yl]-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2ccc(-c3ccnc(OCCCc4cccnc4)n3)cc2s1 |
| InChI | InChI=1S/C21H19N5O2S/c1-14(27)24-21-26-18-7-6-16(12-19(18)29-21)17-8-10-23-20(25-17)28-11-3-5-15-4-2-9-22-13-15/h2,4,6-10,12-13H,3,5,11H2,1H3,(H,24,26,27) |
| InChIKey | AEHPIXXCBRCHDK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|