About (6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one
(6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one (PubChem CID 25182276) has the molecular formula C24H21F2NO3
and a molecular weight of 409.43 g/mol. Its IUPAC name is (6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | (6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one |
| PubChem CID | 25182276 |
| Molecular Formula | C24H21F2NO3 |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one |
| SMILES | O=C1O[C@@](CCO)(c2ccccc2)CCN1c1cccc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C24H21F2NO3/c25-19-9-10-21(22(26)16-19)17-5-4-8-20(15-17)27-13-11-24(12-14-28,30-23(27)29)18-6-2-1-3-7-18/h1-10,15-16,28H,11-14H2/t24-/m0/s1 |
| InChIKey | BRCSKQYCZLOWED-DEOSSOPVSA-N |
| XLogP | 5.26 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one?
The IUPAC name of (6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one (CID 25182276) is (6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one.
What is the SMILES notation for (6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one?
The canonical SMILES for (6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one is O=C1O[C@@](CCO)(c2ccccc2)CCN1c1cccc(-c2ccc(F)cc2F)c1.
What is the InChIKey of (6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one?
The InChIKey is BRCSKQYCZLOWED-DEOSSOPVSA-N. The full InChI is InChI=1S/C24H21F2NO3/c25-19-9-10-21(22(26)16-19)17-5-4-8-20(15-17)27-13-11-24(12-14-28,30-23(27)29)18-6-2-1-3-7-18/h1-10,15-16,28H,11-14H2/t24-/m0/s1.
What are the key properties of (6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one?
(6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one has a molecular weight of 409.43 g/mol, XLogP of 5.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-3-[3-(2,4-difluorophenyl)phenyl]-6-(2-hydroxyethyl)-6-phenyl-1,3-oxazinan-2-one is sourced from PubChem (CID 25182276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).