C25H23FN4O4S — CID 25182528
N-[[(1S,2S,5R)-3-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide (PubChem CID 25182528) has the molecular formula C25H23FN4O4S and a molecular weight of 494.55 g/mol. Its IUPAC name is N-[[(1S,2S,5R)-3-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
| Compound Name | N-[[(1S,2S,5R)-3-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
|---|---|
| PubChem CID | 25182528 |
| Molecular Formula | C25H23FN4O4S |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N-[[(1S,2S,5R)-3-[2-amino-5-(3-fluorophenyl)-1,3-thiazole-4-carbonyl]-3-azabicyclo[3.1.0]hexan-2-yl]methyl]-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | Nc1nc(C(=O)N2C[C@@H]3C[C@@H]3[C@H]2CNC(=O)c2cccc3c2OCCO3)c(-c2cccc(F)c2)s1 |
| InChI | InChI=1S/C25H23FN4O4S/c26-15-4-1-3-13(9-15)22-20(29-25(27)35-22)24(32)30-12-14-10-17(14)18(30)11-28-23(31)16-5-2-6-19-21(16)34-8-7-33-19/h1-6,9,14,17-18H,7-8,10-12H2,(H2,27,29)(H,28,31)/t14-,17-,18+/m0/s1 |
| InChIKey | ARGNEUPSWWWVNM-JCGIZDLHSA-N |
| XLogP | 3.19 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |