C19H14Cl3F3N2O2 — CID 25182662
2-chloro-N-[[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]acetamide (PubChem CID 25182662) has the molecular formula C19H14Cl3F3N2O2 and a molecular weight of 465.69 g/mol. Its IUPAC name is 2-chloro-N-[[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]acetamide.
| Compound Name | 2-chloro-N-[[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 25182662 |
| Molecular Formula | C19H14Cl3F3N2O2 |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | 2-chloro-N-[[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]methyl]acetamide |
| SMILES | O=C(CCl)NCc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C19H14Cl3F3N2O2/c20-9-17(28)26-10-11-1-3-12(4-2-11)16-8-18(29-27-16,19(23,24)25)13-5-14(21)7-15(22)6-13/h1-7H,8-10H2,(H,26,28) |
| InChIKey | ULUNJRLKQROLOO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|