About spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine]
spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine] (PubChem CID 25183140) has the molecular formula C17H17NOS
and a molecular weight of 283.40 g/mol. Its IUPAC name is spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine].
Molecular Properties
| Compound Name | spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine] |
| PubChem CID | 25183140 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine] |
| SMILES | c1ccc2c(c1)CC1(CNCCO1)c1ccccc1S2 |
| InChI | InChI=1S/C17H17NOS/c1-3-7-15-13(5-1)11-17(12-18-9-10-19-17)14-6-2-4-8-16(14)20-15/h1-8,18H,9-12H2 |
| InChIKey | UVQYFISHQPAHDB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine]?
The IUPAC name of spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine] (CID 25183140) is spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine].
What is the SMILES notation for spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine]?
The canonical SMILES for spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine] is c1ccc2c(c1)CC1(CNCCO1)c1ccccc1S2.
What is the InChIKey of spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine]?
The InChIKey is UVQYFISHQPAHDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NOS/c1-3-7-15-13(5-1)11-17(12-18-9-10-19-17)14-6-2-4-8-16(14)20-15/h1-8,18H,9-12H2.
What are the key properties of spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine]?
spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine] has a molecular weight of 283.40 g/mol, XLogP of 3.21, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine] is sourced from PubChem (CID 25183140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).