About 1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol
1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol (PubChem CID 25183381) has the molecular formula C10H13FN6O4
and a molecular weight of 299.25 g/mol. Its IUPAC name is 1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol.
Molecular Properties
| Compound Name | 1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol |
| PubChem CID | 25183381 |
| Molecular Formula | C10H13FN6O4 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol |
| SMILES | O=[N+]([O-])c1nccn1Cc1cn(CC(O)C(O)C[18F])nn1 |
| InChI | InChI=1S/C10H13FN6O4/c11-3-8(18)9(19)6-16-5-7(13-14-16)4-15-2-1-12-10(15)17(20)21/h1-2,5,8-9,18-19H,3-4,6H2/i11-1 |
| InChIKey | ZOZSMFCVTTYYQY-KXMUYVCJSA-N |
| XLogP | -0.88 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol?
The IUPAC name of 1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol (CID 25183381) is 1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol.
What is the SMILES notation for 1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol?
The canonical SMILES for 1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol is O=[N+]([O-])c1nccn1Cc1cn(CC(O)C(O)C[18F])nn1.
What is the InChIKey of 1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol?
The InChIKey is ZOZSMFCVTTYYQY-KXMUYVCJSA-N. The full InChI is InChI=1S/C10H13FN6O4/c11-3-8(18)9(19)6-16-5-7(13-14-16)4-15-2-1-12-10(15)17(20)21/h1-2,5,8-9,18-19H,3-4,6H2/i11-1.
What are the key properties of 1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol?
1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol has a molecular weight of 299.25 g/mol, XLogP of -0.88, 7 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(18F)fluoro-4-[4-[(2-nitroimidazol-1-yl)methyl]triazol-1-yl]butane-2,3-diol is sourced from PubChem (CID 25183381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).