C23H32N6O4 — CID 25183448
6-(2-ethoxyethoxy)-11-methyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(23),3,5,17,20(24),21-hexaen-10-one (PubChem CID 25183448) has the molecular formula C23H32N6O4 and a molecular weight of 456.55 g/mol. Its IUPAC name is 6-(2-ethoxyethoxy)-11-methyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(23),3,5,17,20(24),21-hexaen-10-one.
| Compound Name | 6-(2-ethoxyethoxy)-11-methyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(23),3,5,17,20(24),21-hexaen-10-one |
|---|---|
| PubChem CID | 25183448 |
| Molecular Formula | C23H32N6O4 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 6-(2-ethoxyethoxy)-11-methyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(23),3,5,17,20(24),21-hexaen-10-one |
| SMILES | CCOCCOC1=CC=C2CC1OCC(=O)N(C)CCCNCc1c[nH]c3ncnc(c13)N2 |
| InChI | InChI=1S/C23H32N6O4/c1-3-31-9-10-32-18-6-5-17-11-19(18)33-14-20(30)29(2)8-4-7-24-12-16-13-25-22-21(16)23(28-17)27-15-26-22/h5-6,13,15,19,24H,3-4,7-12,14H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | GZAWTRMWULUABZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|