C16H23ClN2O3 — CID 25183617
3-(2-chloroethyl)-2-methyl-9-(oxan-2-yloxy)-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 25183617) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is 3-(2-chloroethyl)-2-methyl-9-(oxan-2-yloxy)-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-(2-chloroethyl)-2-methyl-9-(oxan-2-yloxy)-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 25183617 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 3-(2-chloroethyl)-2-methyl-9-(oxan-2-yloxy)-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1nc2n(c(=O)c1CCCl)CCCC2OC1CCCCO1 |
| InChI | InChI=1S/C16H23ClN2O3/c1-11-12(7-8-17)16(20)19-9-4-5-13(15(19)18-11)22-14-6-2-3-10-21-14/h13-14H,2-10H2,1H3 |
| InChIKey | SQJKKBLFPYNVAH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|