C28H24N6O2S — CID 25183715
6-methyl-N-[[(1S,2S,5R)-3-(2-phenyl-1,6-naphthyridine-3-carbonyl)-3-azabicyclo[3.1.0]hexan-2-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide (PubChem CID 25183715) has the molecular formula C28H24N6O2S and a molecular weight of 508.61 g/mol. Its IUPAC name is 6-methyl-N-[[(1S,2S,5R)-3-(2-phenyl-1,6-naphthyridine-3-carbonyl)-3-azabicyclo[3.1.0]hexan-2-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide.
| Compound Name | 6-methyl-N-[[(1S,2S,5R)-3-(2-phenyl-1,6-naphthyridine-3-carbonyl)-3-azabicyclo[3.1.0]hexan-2-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 25183715 |
| Molecular Formula | C28H24N6O2S |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 6-methyl-N-[[(1S,2S,5R)-3-(2-phenyl-1,6-naphthyridine-3-carbonyl)-3-azabicyclo[3.1.0]hexan-2-yl]methyl]imidazo[2,1-b][1,3]thiazole-5-carboxamide |
| SMILES | Cc1nc2sccn2c1C(=O)NC[C@@H]1[C@H]2C[C@H]2CN1C(=O)c1cc2cnccc2nc1-c1ccccc1 |
| InChI | InChI=1S/C28H24N6O2S/c1-16-25(33-9-10-37-28(33)31-16)26(35)30-14-23-20-12-19(20)15-34(23)27(36)21-11-18-13-29-8-7-22(18)32-24(21)17-5-3-2-4-6-17/h2-11,13,19-20,23H,12,14-15H2,1H3,(H,30,35)/t19-,20-,23+/m0/s1 |
| InChIKey | RJGUNXWQKBBABI-SXWKCWPCSA-N |
| XLogP | 4.20 |
| TPSA | 92.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |