C15H11F2N3O2 — CID 25184009
2-fluoroethyl 2-(6-fluoro-3-pyridinyl)imidazo[1,2-a]pyridine-6-carboxylate (PubChem CID 25184009) has the molecular formula C15H11F2N3O2 and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-fluoroethyl 2-(6-fluoro-3-pyridinyl)imidazo[1,2-a]pyridine-6-carboxylate.
| Compound Name | 2-fluoroethyl 2-(6-fluoro-3-pyridinyl)imidazo[1,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 25184009 |
| Molecular Formula | C15H11F2N3O2 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 2-fluoroethyl 2-(6-fluoro-3-pyridinyl)imidazo[1,2-a]pyridine-6-carboxylate |
| SMILES | O=C(OCCF)c1ccc2nc(-c3ccc(F)nc3)cn2c1 |
| InChI | InChI=1S/C15H11F2N3O2/c16-5-6-22-15(21)11-2-4-14-19-12(9-20(14)8-11)10-1-3-13(17)18-7-10/h1-4,7-9H,5-6H2 |
| InChIKey | RTMNEBMUQREWMJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|