C22H26N4OSSi — CID 25184385
N-(2-amino-5-thiophen-2-ylphenyl)-6-(4,4-dimethyl-1,4-azasilinan-1-yl)pyridine-3-carboxamide (PubChem CID 25184385) has the molecular formula C22H26N4OSSi and a molecular weight of 422.63 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-6-(4,4-dimethyl-1,4-azasilinan-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(4,4-dimethyl-1,4-azasilinan-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25184385 |
| Molecular Formula | C22H26N4OSSi |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-6-(4,4-dimethyl-1,4-azasilinan-1-yl)pyridine-3-carboxamide |
| SMILES | C[Si]1(C)CCN(c2ccc(C(=O)Nc3cc(-c4cccs4)ccc3N)cn2)CC1 |
| InChI | InChI=1S/C22H26N4OSSi/c1-29(2)12-9-26(10-13-29)21-8-6-17(15-24-21)22(27)25-19-14-16(5-7-18(19)23)20-4-3-11-28-20/h3-8,11,14-15H,9-10,12-13,23H2,1-2H3,(H,25,27) |
| InChIKey | QGRBXFBMKUQEAQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|