C25H21F4N5O — CID 25184936
9-[3-(2-fluoro-3-pyridinyl)phenyl]-9-[4-(trifluoromethoxy)phenyl]-2,3,4,5-tetrahydroimidazo[1,5-a][1,3]diazepin-7-amine (PubChem CID 25184936) has the molecular formula C25H21F4N5O and a molecular weight of 483.47 g/mol. Its IUPAC name is 9-[3-(2-fluoro-3-pyridinyl)phenyl]-9-[4-(trifluoromethoxy)phenyl]-2,3,4,5-tetrahydroimidazo[1,5-a][1,3]diazepin-7-amine.
| Compound Name | 9-[3-(2-fluoro-3-pyridinyl)phenyl]-9-[4-(trifluoromethoxy)phenyl]-2,3,4,5-tetrahydroimidazo[1,5-a][1,3]diazepin-7-amine |
|---|---|
| PubChem CID | 25184936 |
| Molecular Formula | C25H21F4N5O |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 9-[3-(2-fluoro-3-pyridinyl)phenyl]-9-[4-(trifluoromethoxy)phenyl]-2,3,4,5-tetrahydroimidazo[1,5-a][1,3]diazepin-7-amine |
| SMILES | NC1=NC(c2ccc(OC(F)(F)F)cc2)(c2cccc(-c3cccnc3F)c2)C2=NCCCCN12 |
| InChI | InChI=1S/C25H21F4N5O/c26-21-20(7-4-13-31-21)16-5-3-6-18(15-16)24(17-8-10-19(11-9-17)35-25(27,28)29)22-32-12-1-2-14-34(22)23(30)33-24/h3-11,13,15H,1-2,12,14H2,(H2,30,33) |
| InChIKey | AMHTVOUZASNVCQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|