C12H7F4NO3S — CID 25185171
(5Z)-5-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 25185171) has the molecular formula C12H7F4NO3S and a molecular weight of 321.25 g/mol. Its IUPAC name is (5Z)-5-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 25185171 |
| Molecular Formula | C12H7F4NO3S |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | (5Z)-5-[[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cccc(OC(F)(F)C(F)F)c2)S1 |
| InChI | InChI=1S/C12H7F4NO3S/c13-10(14)12(15,16)20-7-3-1-2-6(4-7)5-8-9(18)17-11(19)21-8/h1-5,10H,(H,17,18,19)/b8-5- |
| InChIKey | LZYNQCBXFYBAGT-YVMONPNESA-N |
| XLogP | 3.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|