C21H30N2O7 — CID 25185407
dimethyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanedioate (PubChem CID 25185407) has the molecular formula C21H30N2O7 and a molecular weight of 422.48 g/mol. Its IUPAC name is dimethyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 25185407 |
| Molecular Formula | C21H30N2O7 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | dimethyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanedioate |
| SMILES | COC(=O)CC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C21H30N2O7/c1-21(2,3)30-20(27)23-16(13-14-9-7-6-8-10-14)18(25)22-15(19(26)29-5)11-12-17(24)28-4/h6-10,15-16H,11-13H2,1-5H3,(H,22,25)(H,23,27)/t15-,16-/m0/s1 |
| InChIKey | AGUQSBSTOQTAKG-HOTGVXAUSA-N |
| XLogP | 1.73 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|