About [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate
[2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate (PubChem CID 25185571) has the molecular formula C16H18N2O5S2
and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate.
Molecular Properties
| Compound Name | [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate |
| PubChem CID | 25185571 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)Oc1ccccc1C(=O)Nc1ncc(S(C)(=O)=O)s1 |
| InChI | InChI=1S/C16H18N2O5S2/c1-10(2)8-13(19)23-12-7-5-4-6-11(12)15(20)18-16-17-9-14(24-16)25(3,21)22/h4-7,9-10H,8H2,1-3H3,(H,17,18,20) |
| InChIKey | WMMVFUFDRWITEH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate?
The IUPAC name of [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate (CID 25185571) is [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate.
What is the SMILES notation for [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate?
The canonical SMILES for [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate is CC(C)CC(=O)Oc1ccccc1C(=O)Nc1ncc(S(C)(=O)=O)s1.
What is the InChIKey of [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate?
The InChIKey is WMMVFUFDRWITEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5S2/c1-10(2)8-13(19)23-12-7-5-4-6-11(12)15(20)18-16-17-9-14(24-16)25(3,21)22/h4-7,9-10H,8H2,1-3H3,(H,17,18,20).
What are the key properties of [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate?
[2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate has a molecular weight of 382.46 g/mol, XLogP of 2.75, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 3-methylbutanoate is sourced from PubChem (CID 25185571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).