About 4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine
4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine (PubChem CID 25185936) has the molecular formula C20H20N2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine.
Molecular Properties
| Compound Name | 4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine |
| PubChem CID | 25185936 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine |
| SMILES | Cc1cc(-c2ccc(-c3cc(C)nc(C)c3)cc2)cc(C)n1 |
| InChI | InChI=1S/C20H20N2/c1-13-9-19(10-14(2)21-13)17-5-7-18(8-6-17)20-11-15(3)22-16(4)12-20/h5-12H,1-4H3 |
| InChIKey | FLMQKAGQIXYIQI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine?
The IUPAC name of 4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine (CID 25185936) is 4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine.
What is the SMILES notation for 4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine?
The canonical SMILES for 4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine is Cc1cc(-c2ccc(-c3cc(C)nc(C)c3)cc2)cc(C)n1.
What is the InChIKey of 4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine?
The InChIKey is FLMQKAGQIXYIQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2/c1-13-9-19(10-14(2)21-13)17-5-7-18(8-6-17)20-11-15(3)22-16(4)12-20/h5-12H,1-4H3.
What are the key properties of 4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine?
4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine has a molecular weight of 288.39 g/mol, XLogP of 5.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine is sourced from PubChem (CID 25185936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).