C33H54N6O6 — CID 25186012
1-octyl-N-[7-[(1-octyl-2,4-dioxopyrimidine-5-carbonyl)amino]heptyl]-2,4-dioxopyrimidine-5-carboxamide (PubChem CID 25186012) has the molecular formula C33H54N6O6 and a molecular weight of 630.83 g/mol. Its IUPAC name is 1-octyl-N-[7-[(1-octyl-2,4-dioxopyrimidine-5-carbonyl)amino]heptyl]-2,4-dioxopyrimidine-5-carboxamide.
| Compound Name | 1-octyl-N-[7-[(1-octyl-2,4-dioxopyrimidine-5-carbonyl)amino]heptyl]-2,4-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 25186012 |
| Molecular Formula | C33H54N6O6 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.41 |
| IUPAC Name | 1-octyl-N-[7-[(1-octyl-2,4-dioxopyrimidine-5-carbonyl)amino]heptyl]-2,4-dioxopyrimidine-5-carboxamide |
| SMILES | CCCCCCCCn1cc(C(=O)NCCCCCCCNC(=O)c2cn(CCCCCCCC)c(=O)[nH]c2=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C33H54N6O6/c1-3-5-7-9-14-18-22-38-24-26(30(42)36-32(38)44)28(40)34-20-16-12-11-13-17-21-35-29(41)27-25-39(33(45)37-31(27)43)23-19-15-10-8-6-4-2/h24-25H,3-23H2,1-2H3,(H,34,40)(H,35,41)(H,36,42,44)(H,37,43,45) |
| InChIKey | IWVMQZZSXBYROL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 167.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|