C12H14N2O — CID 25186020
6-methoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole (PubChem CID 25186020) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole.
| Compound Name | 6-methoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 25186020 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 6-methoxy-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
| SMILES | COc1cccc2cc3n(c12)CCNC3 |
| InChI | InChI=1S/C12H14N2O/c1-15-11-4-2-3-9-7-10-8-13-5-6-14(10)12(9)11/h2-4,7,13H,5-6,8H2,1H3 |
| InChIKey | NVWYMOYTOXXDBN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |