About [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate
[2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate (PubChem CID 25186116) has the molecular formula C21H20N2O5S2
and a molecular weight of 444.53 g/mol. Its IUPAC name is [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate.
Molecular Properties
| Compound Name | [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate |
| PubChem CID | 25186116 |
| Molecular Formula | C21H20N2O5S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate |
| SMILES | CC(Cc1ccccc1)C(=O)Oc1ccccc1C(=O)Nc1ncc(S(C)(=O)=O)s1 |
| InChI | InChI=1S/C21H20N2O5S2/c1-14(12-15-8-4-3-5-9-15)20(25)28-17-11-7-6-10-16(17)19(24)23-21-22-13-18(29-21)30(2,26)27/h3-11,13-14H,12H2,1-2H3,(H,22,23,24) |
| InChIKey | BDFIFIHLUQZBBB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate?
The IUPAC name of [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate (CID 25186116) is [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate.
What is the SMILES notation for [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate?
The canonical SMILES for [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate is CC(Cc1ccccc1)C(=O)Oc1ccccc1C(=O)Nc1ncc(S(C)(=O)=O)s1.
What is the InChIKey of [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate?
The InChIKey is BDFIFIHLUQZBBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O5S2/c1-14(12-15-8-4-3-5-9-15)20(25)28-17-11-7-6-10-16(17)19(24)23-21-22-13-18(29-21)30(2,26)27/h3-11,13-14H,12H2,1-2H3,(H,22,23,24).
What are the key properties of [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate?
[2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate has a molecular weight of 444.53 g/mol, XLogP of 3.58, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-methylsulfonyl-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-methyl-3-phenylpropanoate is sourced from PubChem (CID 25186116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).