C22H27N9O3S — CID 25186125
(2S)-N-cyano-N'-[3-(2-hydroxyethylsulfamoyl)phenyl]-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboximidamide (PubChem CID 25186125) has the molecular formula C22H27N9O3S and a molecular weight of 497.59 g/mol. Its IUPAC name is (2S)-N-cyano-N'-[3-(2-hydroxyethylsulfamoyl)phenyl]-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboximidamide.
| Compound Name | (2S)-N-cyano-N'-[3-(2-hydroxyethylsulfamoyl)phenyl]-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 25186125 |
| Molecular Formula | C22H27N9O3S |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | (2S)-N-cyano-N'-[3-(2-hydroxyethylsulfamoyl)phenyl]-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboximidamide |
| SMILES | Cc1c[nH]c2ncnc(N3CCN(/C(=N/c4cccc(S(=O)(=O)NCCO)c4)NC#N)[C@@H](C)C3)c12 |
| InChI | InChI=1S/C22H27N9O3S/c1-15-11-24-20-19(15)21(27-14-26-20)30-7-8-31(16(2)12-30)22(25-13-23)29-17-4-3-5-18(10-17)35(33,34)28-6-9-32/h3-5,10-11,14,16,28,32H,6-9,12H2,1-2H3,(H,25,29)(H,24,26,27)/t16-/m0/s1 |
| InChIKey | DHODDWMFDDAHDC-INIZCTEOSA-N |
| XLogP | 0.81 |
| TPSA | 162.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|