C23H28N8 — CID 25186128
(2S)-N-cyano-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N'-(3-propan-2-ylphenyl)piperazine-1-carboximidamide (PubChem CID 25186128) has the molecular formula C23H28N8 and a molecular weight of 416.53 g/mol. Its IUPAC name is (2S)-N-cyano-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N'-(3-propan-2-ylphenyl)piperazine-1-carboximidamide.
| Compound Name | (2S)-N-cyano-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N'-(3-propan-2-ylphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 25186128 |
| Molecular Formula | C23H28N8 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (2S)-N-cyano-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-N'-(3-propan-2-ylphenyl)piperazine-1-carboximidamide |
| SMILES | Cc1c[nH]c2ncnc(N3CCN(/C(=N/c4cccc(C(C)C)c4)NC#N)[C@@H](C)C3)c12 |
| InChI | InChI=1S/C23H28N8/c1-15(2)18-6-5-7-19(10-18)29-23(26-13-24)31-9-8-30(12-17(31)4)22-20-16(3)11-25-21(20)27-14-28-22/h5-7,10-11,14-15,17H,8-9,12H2,1-4H3,(H,26,29)(H,25,27,28)/t17-/m0/s1 |
| InChIKey | MNWRMSXUTYDXNY-KRWDZBQOSA-N |
| XLogP | 3.66 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|