About phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate
phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate (PubChem CID 25186202) has the molecular formula C10H5F6IO3S
and a molecular weight of 446.11 g/mol. Its IUPAC name is phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate |
| PubChem CID | 25186202 |
| Molecular Formula | C10H5F6IO3S |
| Molecular Weight | 446.11 g/mol |
| Exact Mass | 445.89 |
| IUPAC Name | phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate |
| SMILES | FC(F)(F)C#C[I+]c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H5F3I.CHF3O3S/c10-9(11,12)6-7-13-8-4-2-1-3-5-8;2-1(3,4)8(5,6)7/h1-5H;(H,5,6,7)/q+1;/p-1 |
| InChIKey | MJHQRYPCNLSRQM-UHFFFAOYSA-M |
| XLogP | -0.48 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.11 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate?
The IUPAC name of phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate (CID 25186202) is phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate.
What is the SMILES notation for phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate?
The canonical SMILES for phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate is FC(F)(F)C#C[I+]c1ccccc1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate?
The InChIKey is MJHQRYPCNLSRQM-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H5F3I.CHF3O3S/c10-9(11,12)6-7-13-8-4-2-1-3-5-8;2-1(3,4)8(5,6)7/h1-5H;(H,5,6,7)/q+1;/p-1.
What are the key properties of phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate?
phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate has a molecular weight of 446.11 g/mol, XLogP of -0.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl(3,3,3-trifluoroprop-1-ynyl)iodanium;trifluoromethanesulfonate is sourced from PubChem (CID 25186202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).