C19H15FN2O2 — CID 25186450
2-[(5-fluoro-6-phenyl-3-pyridinyl)amino]-5-methylbenzoic acid (PubChem CID 25186450) has the molecular formula C19H15FN2O2 and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-[(5-fluoro-6-phenyl-3-pyridinyl)amino]-5-methylbenzoic acid.
| Compound Name | 2-[(5-fluoro-6-phenyl-3-pyridinyl)amino]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 25186450 |
| Molecular Formula | C19H15FN2O2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 2-[(5-fluoro-6-phenyl-3-pyridinyl)amino]-5-methylbenzoic acid |
| SMILES | Cc1ccc(Nc2cnc(-c3ccccc3)c(F)c2)c(C(=O)O)c1 |
| InChI | InChI=1S/C19H15FN2O2/c1-12-7-8-17(15(9-12)19(23)24)22-14-10-16(20)18(21-11-14)13-5-3-2-4-6-13/h2-11,22H,1H3,(H,23,24) |
| InChIKey | PFGOXABJGOKVCN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |