C22H28O4 — CID 25186745
(4aR,7Z,9R,11aR)-9-[(4-methoxyphenyl)methoxy]-7-methyl-11-methylidene-1,4,4a,5,6,9,10,11a-octahydrocyclonona[c]pyran-3-one (PubChem CID 25186745) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (4aR,7Z,9R,11aR)-9-[(4-methoxyphenyl)methoxy]-7-methyl-11-methylidene-1,4,4a,5,6,9,10,11a-octahydrocyclonona[c]pyran-3-one.
| Compound Name | (4aR,7Z,9R,11aR)-9-[(4-methoxyphenyl)methoxy]-7-methyl-11-methylidene-1,4,4a,5,6,9,10,11a-octahydrocyclonona[c]pyran-3-one |
|---|---|
| PubChem CID | 25186745 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (4aR,7Z,9R,11aR)-9-[(4-methoxyphenyl)methoxy]-7-methyl-11-methylidene-1,4,4a,5,6,9,10,11a-octahydrocyclonona[c]pyran-3-one |
| SMILES | C=C1C[C@@H](OCc2ccc(OC)cc2)/C=C(/C)CC[C@@H]2CC(=O)OC[C@@H]12 |
| InChI | InChI=1S/C22H28O4/c1-15-4-7-18-12-22(23)26-14-21(18)16(2)11-20(10-15)25-13-17-5-8-19(24-3)9-6-17/h5-6,8-10,18,20-21H,2,4,7,11-14H2,1,3H3/b15-10-/t18-,20+,21+/m1/s1 |
| InChIKey | GGDOSBBRFQQWMQ-BCJSJRSGSA-N |
| XLogP | 4.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|