About (2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol
(2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol (PubChem CID 25186922) has the molecular formula C17H18O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is (2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol.
Molecular Properties
| Compound Name | (2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol |
| PubChem CID | 25186922 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol |
| SMILES | Cc1cc2c(c(C)c1O)O[C@H](c1ccc(O)cc1)CC2 |
| InChI | InChI=1S/C17H18O3/c1-10-9-13-5-8-15(12-3-6-14(18)7-4-12)20-17(13)11(2)16(10)19/h3-4,6-7,9,15,18-19H,5,8H2,1-2H3/t15-/m0/s1 |
| InChIKey | KCZHOHKFLRXJSV-HNNXBMFYSA-N |
| XLogP | 3.78 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol?
The IUPAC name of (2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol (CID 25186922) is (2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol.
What is the SMILES notation for (2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol?
The canonical SMILES for (2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol is Cc1cc2c(c(C)c1O)O[C@H](c1ccc(O)cc1)CC2.
What is the InChIKey of (2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol?
The InChIKey is KCZHOHKFLRXJSV-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H18O3/c1-10-9-13-5-8-15(12-3-6-14(18)7-4-12)20-17(13)11(2)16(10)19/h3-4,6-7,9,15,18-19H,5,8H2,1-2H3/t15-/m0/s1.
What are the key properties of (2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol?
(2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol has a molecular weight of 270.33 g/mol, XLogP of 3.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(4-hydroxyphenyl)-6,8-dimethyl-3,4-dihydro-2H-chromen-7-ol is sourced from PubChem (CID 25186922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).