C16H16O2S — CID 25187088
2-[(1S,2R,5R,7S)-10-oxa-3-thiatricyclo[5.2.1.01,5]dec-8-en-2-yl]-1-phenylethanone (PubChem CID 25187088) has the molecular formula C16H16O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-[(1S,2R,5R,7S)-10-oxa-3-thiatricyclo[5.2.1.01,5]dec-8-en-2-yl]-1-phenylethanone.
| Compound Name | 2-[(1S,2R,5R,7S)-10-oxa-3-thiatricyclo[5.2.1.01,5]dec-8-en-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 25187088 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-[(1S,2R,5R,7S)-10-oxa-3-thiatricyclo[5.2.1.01,5]dec-8-en-2-yl]-1-phenylethanone |
| SMILES | O=C(C[C@H]1SC[C@@H]2C[C@H]3C=C[C@]21O3)c1ccccc1 |
| InChI | InChI=1S/C16H16O2S/c17-14(11-4-2-1-3-5-11)9-15-16-7-6-13(18-16)8-12(16)10-19-15/h1-7,12-13,15H,8-10H2/t12-,13+,15+,16-/m0/s1 |
| InChIKey | XFVKCQAZVSNVBW-XNISGKROSA-N |
| XLogP | 3.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|