C22H22N2O3 — CID 25187282
2-[[6-(3-ethoxyphenyl)-4-methyl-3-pyridinyl]amino]-5-methylbenzoic acid (PubChem CID 25187282) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[[6-(3-ethoxyphenyl)-4-methyl-3-pyridinyl]amino]-5-methylbenzoic acid.
| Compound Name | 2-[[6-(3-ethoxyphenyl)-4-methyl-3-pyridinyl]amino]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 25187282 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[[6-(3-ethoxyphenyl)-4-methyl-3-pyridinyl]amino]-5-methylbenzoic acid |
| SMILES | CCOc1cccc(-c2cc(C)c(Nc3ccc(C)cc3C(=O)O)cn2)c1 |
| InChI | InChI=1S/C22H22N2O3/c1-4-27-17-7-5-6-16(12-17)20-11-15(3)21(13-23-20)24-19-9-8-14(2)10-18(19)22(25)26/h5-13,24H,4H2,1-3H3,(H,25,26) |
| InChIKey | MPVNLZRLXIKJFP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |