C27H48O4Si — CID 25187314
[(3R,4R,6R,7R,8R,9S)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-8-methoxy-7,9-dimethyltridec-1-en-11-yn-4-yl] prop-2-enoate (PubChem CID 25187314) has the molecular formula C27H48O4Si and a molecular weight of 464.76 g/mol. Its IUPAC name is [(3R,4R,6R,7R,8R,9S)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-8-methoxy-7,9-dimethyltridec-1-en-11-yn-4-yl] prop-2-enoate.
| Compound Name | [(3R,4R,6R,7R,8R,9S)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-8-methoxy-7,9-dimethyltridec-1-en-11-yn-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 25187314 |
| Molecular Formula | C27H48O4Si |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | [(3R,4R,6R,7R,8R,9S)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-8-methoxy-7,9-dimethyltridec-1-en-11-yn-4-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@H](C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](OC)[C@@H](C)CC#CC)[C@@H](C=C)CC |
| InChI | InChI=1S/C27H48O4Si/c1-13-17-18-20(5)26(29-10)21(6)23(31-32(11,12)27(7,8)9)19-24(22(14-2)15-3)30-25(28)16-4/h14,16,20-24,26H,2,4,15,18-19H2,1,3,5-12H3/t20-,21-,22-,23+,24+,26+/m0/s1 |
| InChIKey | CATMNFAYLDYPGD-ICORKZACSA-N |
| XLogP | 6.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|