C24H26ClF2NO5S2 — CID 25187781
(1S,2R,4R,7S)-10-(4-chlorophenyl)sulfonyl-12,15-difluoro-4-propyl-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5,5-dioxide (PubChem CID 25187781) has the molecular formula C24H26ClF2NO5S2 and a molecular weight of 546.06 g/mol. Its IUPAC name is (1S,2R,4R,7S)-10-(4-chlorophenyl)sulfonyl-12,15-difluoro-4-propyl-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5,5-dioxide.
| Compound Name | (1S,2R,4R,7S)-10-(4-chlorophenyl)sulfonyl-12,15-difluoro-4-propyl-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5,5-dioxide |
|---|---|
| PubChem CID | 25187781 |
| Molecular Formula | C24H26ClF2NO5S2 |
| Molecular Weight | 546.06 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | (1S,2R,4R,7S)-10-(4-chlorophenyl)sulfonyl-12,15-difluoro-4-propyl-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5,5-dioxide |
| SMILES | CCC[C@@H]1C[C@H]2[C@H](CCC3(S(=O)(=O)c4ccc(Cl)cc4)c4c(F)ccc(F)c4OC[C@H]23)NS1(=O)=O |
| InChI | InChI=1S/C24H26ClF2NO5S2/c1-2-3-16-12-17-18-13-33-23-20(27)9-8-19(26)22(23)24(18,11-10-21(17)28-35(16,31)32)34(29,30)15-6-4-14(25)5-7-15/h4-9,16-18,21,28H,2-3,10-13H2,1H3/t16-,17-,18-,21+,24?/m1/s1 |
| InChIKey | KKENEUCLOLQBPU-XFULYNLSSA-N |
| XLogP | 4.57 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.06 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |