C14H29NO4Si — CID 25187938
ethyl (2S,3R)-2-acetyl-4-methyl-3-(trimethylsilyloxyamino)hexanoate (PubChem CID 25187938) has the molecular formula C14H29NO4Si and a molecular weight of 303.48 g/mol. Its IUPAC name is ethyl (2S,3R)-2-acetyl-4-methyl-3-(trimethylsilyloxyamino)hexanoate.
| Compound Name | ethyl (2S,3R)-2-acetyl-4-methyl-3-(trimethylsilyloxyamino)hexanoate |
|---|---|
| PubChem CID | 25187938 |
| Molecular Formula | C14H29NO4Si |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | ethyl (2S,3R)-2-acetyl-4-methyl-3-(trimethylsilyloxyamino)hexanoate |
| SMILES | CCOC(=O)[C@H](C(C)=O)[C@H](NO[Si](C)(C)C)C(C)CC |
| InChI | InChI=1S/C14H29NO4Si/c1-8-10(3)13(15-19-20(5,6)7)12(11(4)16)14(17)18-9-2/h10,12-13,15H,8-9H2,1-7H3/t10?,12-,13-/m1/s1 |
| InChIKey | WPIRXEJKWDIUPG-SKVSWLLESA-N |
| XLogP | 2.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|