About methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate
methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate (PubChem CID 25187963) has the molecular formula C15H18O4
and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate |
| PubChem CID | 25187963 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate |
| SMILES | C=C1C=C(CCC(=O)OC)C(=O)OC1/C=C/C=C/C |
| InChI | InChI=1S/C15H18O4/c1-4-5-6-7-13-11(2)10-12(15(17)19-13)8-9-14(16)18-3/h4-7,10,13H,2,8-9H2,1,3H3/b5-4+,7-6+ |
| InChIKey | UKDFTLJGSIJPSC-YTXTXJHMSA-N |
| XLogP | 2.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate?
The IUPAC name of methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate (CID 25187963) is methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate.
What is the SMILES notation for methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate?
The canonical SMILES for methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate is C=C1C=C(CCC(=O)OC)C(=O)OC1/C=C/C=C/C.
What is the InChIKey of methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate?
The InChIKey is UKDFTLJGSIJPSC-YTXTXJHMSA-N. The full InChI is InChI=1S/C15H18O4/c1-4-5-6-7-13-11(2)10-12(15(17)19-13)8-9-14(16)18-3/h4-7,10,13H,2,8-9H2,1,3H3/b5-4+,7-6+.
What are the key properties of methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate?
methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate has a molecular weight of 262.31 g/mol, XLogP of 2.48, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoate is sourced from PubChem (CID 25187963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).