About 5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one
5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one (PubChem CID 25187964) has the molecular formula C11H12O2
and a molecular weight of 176.21 g/mol. Its IUPAC name is 5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one.
Molecular Properties
| Compound Name | 5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one |
| PubChem CID | 25187964 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one |
| SMILES | C=C1C=CC(=O)OC1/C=C/C=C/C |
| InChI | InChI=1S/C11H12O2/c1-3-4-5-6-10-9(2)7-8-11(12)13-10/h3-8,10H,2H2,1H3/b4-3+,6-5+ |
| InChIKey | KBPTWVPQNGGLGO-VNKDHWASSA-N |
| XLogP | 2.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one?
The IUPAC name of 5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one (CID 25187964) is 5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one.
What is the SMILES notation for 5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one?
The canonical SMILES for 5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one is C=C1C=CC(=O)OC1/C=C/C=C/C.
What is the InChIKey of 5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one?
The InChIKey is KBPTWVPQNGGLGO-VNKDHWASSA-N. The full InChI is InChI=1S/C11H12O2/c1-3-4-5-6-10-9(2)7-8-11(12)13-10/h3-8,10H,2H2,1H3/b4-3+,6-5+.
What are the key properties of 5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one?
5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one has a molecular weight of 176.21 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylidene-6-[(1E,3E)-penta-1,3-dienyl]pyran-2-one is sourced from PubChem (CID 25187964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).