About 3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine
3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine (PubChem CID 25188209) has the molecular formula C14H10FN7O
and a molecular weight of 311.28 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine |
| PubChem CID | 25188209 |
| Molecular Formula | C14H10FN7O |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine |
| SMILES | Nc1nc(-c2ncco2)c2nnn(Cc3ccccc3F)c2n1 |
| InChI | InChI=1S/C14H10FN7O/c15-9-4-2-1-3-8(9)7-22-12-10(20-21-22)11(18-14(16)19-12)13-17-5-6-23-13/h1-6H,7H2,(H2,16,18,19) |
| InChIKey | YKXAXNRPKPCUCH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine?
The IUPAC name of 3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine (CID 25188209) is 3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine.
What is the SMILES notation for 3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine?
The canonical SMILES for 3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine is Nc1nc(-c2ncco2)c2nnn(Cc3ccccc3F)c2n1.
What is the InChIKey of 3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine?
The InChIKey is YKXAXNRPKPCUCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10FN7O/c15-9-4-2-1-3-8(9)7-22-12-10(20-21-22)11(18-14(16)19-12)13-17-5-6-23-13/h1-6H,7H2,(H2,16,18,19).
What are the key properties of 3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine?
3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine has a molecular weight of 311.28 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-fluorophenyl)methyl]-7-(1,3-oxazol-2-yl)triazolo[4,5-d]pyrimidin-5-amine is sourced from PubChem (CID 25188209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).