About [(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate
[(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate (PubChem CID 25188287) has the molecular formula C12H19NO5
and a molecular weight of 257.29 g/mol. Its IUPAC name is [(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate.
Molecular Properties
| Compound Name | [(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate |
| PubChem CID | 25188287 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | [(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C[C@H](N(O)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H19NO5/c1-8(14)17-10-6-5-9(7-10)13(16)11(15)18-12(2,3)4/h5-6,9-10,16H,7H2,1-4H3/t9-,10+/m0/s1 |
| InChIKey | NYYZWLDQYPQMRW-VHSXEESVSA-N |
| XLogP | 1.87 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate?
The IUPAC name of [(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate (CID 25188287) is [(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate.
What is the SMILES notation for [(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate?
The canonical SMILES for [(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate is CC(=O)O[C@@H]1C=C[C@H](N(O)C(=O)OC(C)(C)C)C1.
What is the InChIKey of [(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate?
The InChIKey is NYYZWLDQYPQMRW-VHSXEESVSA-N. The full InChI is InChI=1S/C12H19NO5/c1-8(14)17-10-6-5-9(7-10)13(16)11(15)18-12(2,3)4/h5-6,9-10,16H,7H2,1-4H3/t9-,10+/m0/s1.
What are the key properties of [(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate?
[(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate has a molecular weight of 257.29 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,4R)-4-[hydroxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]cyclopent-2-en-1-yl] acetate is sourced from PubChem (CID 25188287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).