About 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid
5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid (PubChem CID 25188662) has the molecular formula C19H13F3N2O2
and a molecular weight of 358.32 g/mol. Its IUPAC name is 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid |
| PubChem CID | 25188662 |
| Molecular Formula | C19H13F3N2O2 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid |
| SMILES | Cc1ccc(Nc2ccc(-c3c(F)ccc(F)c3F)nc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C19H13F3N2O2/c1-10-2-6-15(12(8-10)19(25)26)24-11-3-7-16(23-9-11)17-13(20)4-5-14(21)18(17)22/h2-9,24H,1H3,(H,25,26) |
| InChIKey | KTBJLLPRVLRLHC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid?
The IUPAC name of 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid (CID 25188662) is 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid.
What is the SMILES notation for 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid?
The canonical SMILES for 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid is Cc1ccc(Nc2ccc(-c3c(F)ccc(F)c3F)nc2)c(C(=O)O)c1.
What is the InChIKey of 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid?
The InChIKey is KTBJLLPRVLRLHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F3N2O2/c1-10-2-6-15(12(8-10)19(25)26)24-11-3-7-16(23-9-11)17-13(20)4-5-14(21)18(17)22/h2-9,24H,1H3,(H,25,26).
What are the key properties of 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid?
5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid has a molecular weight of 358.32 g/mol, XLogP of 4.92, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-[[6-(2,3,6-trifluorophenyl)-3-pyridinyl]amino]benzoic acid is sourced from PubChem (CID 25188662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).