C17H16O4 — CID 25188731
(2R,4S,5R)-4-hydroxy-4,5-diphenyloxolane-2-carboxylic acid (PubChem CID 25188731) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is (2R,4S,5R)-4-hydroxy-4,5-diphenyloxolane-2-carboxylic acid.
| Compound Name | (2R,4S,5R)-4-hydroxy-4,5-diphenyloxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 25188731 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (2R,4S,5R)-4-hydroxy-4,5-diphenyloxolane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@](O)(c2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C17H16O4/c18-16(19)14-11-17(20,13-9-5-2-6-10-13)15(21-14)12-7-3-1-4-8-12/h1-10,14-15,20H,11H2,(H,18,19)/t14-,15-,17+/m1/s1 |
| InChIKey | FGUUVQJWAJCTJQ-INMHGKMJSA-N |
| XLogP | 2.49 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |