C17H14F2O4 — CID 25188733
(2R,4S,5R)-4,5-bis(4-fluorophenyl)-4-hydroxyoxolane-2-carboxylic acid (PubChem CID 25188733) has the molecular formula C17H14F2O4 and a molecular weight of 320.29 g/mol. Its IUPAC name is (2R,4S,5R)-4,5-bis(4-fluorophenyl)-4-hydroxyoxolane-2-carboxylic acid.
| Compound Name | (2R,4S,5R)-4,5-bis(4-fluorophenyl)-4-hydroxyoxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 25188733 |
| Molecular Formula | C17H14F2O4 |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (2R,4S,5R)-4,5-bis(4-fluorophenyl)-4-hydroxyoxolane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@](O)(c2ccc(F)cc2)[C@@H](c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C17H14F2O4/c18-12-5-1-10(2-6-12)15-17(22,9-14(23-15)16(20)21)11-3-7-13(19)8-4-11/h1-8,14-15,22H,9H2,(H,20,21)/t14-,15-,17+/m1/s1 |
| InChIKey | PXCIQTJROANBGV-INMHGKMJSA-N |
| XLogP | 2.77 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |