C23H14N4OS — CID 25188858
11-(1-benzofuran-2-yl)-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 25188858) has the molecular formula C23H14N4OS and a molecular weight of 394.46 g/mol. Its IUPAC name is 11-(1-benzofuran-2-yl)-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | 11-(1-benzofuran-2-yl)-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 25188858 |
| Molecular Formula | C23H14N4OS |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 11-(1-benzofuran-2-yl)-13-phenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | Nc1ncnc2c1sc1nc(-c3cc4ccccc4o3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C23H14N4OS/c24-22-21-20(25-12-26-22)19-15(13-6-2-1-3-7-13)11-16(27-23(19)29-21)18-10-14-8-4-5-9-17(14)28-18/h1-12H,(H2,24,25,26) |
| InChIKey | XCKAZJYGZYRDKT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |