C14H18O6 — CID 25189025
3-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2H-furan-5-one (PubChem CID 25189025) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 3-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2H-furan-5-one.
| Compound Name | 3-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 25189025 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2H-furan-5-one |
| SMILES | C=CCO[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C1=CC(=O)OC1 |
| InChI | InChI=1S/C14H18O6/c1-4-5-16-11-10(8-6-9(15)17-7-8)18-13-12(11)19-14(2,3)20-13/h4,6,10-13H,1,5,7H2,2-3H3/t10-,11-,12-,13-/m1/s1 |
| InChIKey | PKYQEXJHELMKPT-FDYHWXHSSA-N |
| XLogP | 0.92 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|