About [5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol
[5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol (PubChem CID 25189141) has the molecular formula C22H16ClF2N3O
and a molecular weight of 411.84 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol.
Molecular Properties
| Compound Name | [5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol |
| PubChem CID | 25189141 |
| Molecular Formula | C22H16ClF2N3O |
| Molecular Weight | 411.84 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | [5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol |
| SMILES | Cn1nc(-c2ccc(F)cc2F)c(C(O)c2cccnc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16ClF2N3O/c1-28-21(13-4-6-15(23)7-5-13)19(22(29)14-3-2-10-26-12-14)20(27-28)17-9-8-16(24)11-18(17)25/h2-12,22,29H,1H3 |
| InChIKey | VQYHBWURIAUWGX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.84 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol?
The IUPAC name of [5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol (CID 25189141) is [5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol.
What is the SMILES notation for [5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol?
The canonical SMILES for [5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol is Cn1nc(-c2ccc(F)cc2F)c(C(O)c2cccnc2)c1-c1ccc(Cl)cc1.
What is the InChIKey of [5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol?
The InChIKey is VQYHBWURIAUWGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16ClF2N3O/c1-28-21(13-4-6-15(23)7-5-13)19(22(29)14-3-2-10-26-12-14)20(27-28)17-9-8-16(24)11-18(17)25/h2-12,22,29H,1H3.
What are the key properties of [5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol?
[5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol has a molecular weight of 411.84 g/mol, XLogP of 5.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-chlorophenyl)-3-(2,4-difluorophenyl)-1-methylpyrazol-4-yl]-pyridin-3-ylmethanol is sourced from PubChem (CID 25189141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).