C21H14Cl2N2OS — CID 25189412
[3,5-bis(4-chlorophenyl)-1,2-thiazol-4-yl]-pyridin-3-ylmethanol (PubChem CID 25189412) has the molecular formula C21H14Cl2N2OS and a molecular weight of 413.33 g/mol. Its IUPAC name is [3,5-bis(4-chlorophenyl)-1,2-thiazol-4-yl]-pyridin-3-ylmethanol.
| Compound Name | [3,5-bis(4-chlorophenyl)-1,2-thiazol-4-yl]-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 25189412 |
| Molecular Formula | C21H14Cl2N2OS |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | [3,5-bis(4-chlorophenyl)-1,2-thiazol-4-yl]-pyridin-3-ylmethanol |
| SMILES | OC(c1cccnc1)c1c(-c2ccc(Cl)cc2)nsc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H14Cl2N2OS/c22-16-7-3-13(4-8-16)19-18(20(26)15-2-1-11-24-12-15)21(27-25-19)14-5-9-17(23)10-6-14/h1-12,20,26H |
| InChIKey | RZHFVETWUGUGHT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |