About N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide
N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide (PubChem CID 25189456) has the molecular formula C19H13N3O3
and a molecular weight of 331.33 g/mol. Its IUPAC name is N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide.
Molecular Properties
| Compound Name | N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide |
| PubChem CID | 25189456 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide |
| SMILES | O=C(NO)c1ccc(C2=Nc3ccccc3Oc3ncccc32)cc1 |
| InChI | InChI=1S/C19H13N3O3/c23-18(22-24)13-9-7-12(8-10-13)17-14-4-3-11-20-19(14)25-16-6-2-1-5-15(16)21-17/h1-11,24H,(H,22,23) |
| InChIKey | HZZYVGQOQIFIBP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide?
The IUPAC name of N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide (CID 25189456) is N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide.
What is the SMILES notation for N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide?
The canonical SMILES for N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide is O=C(NO)c1ccc(C2=Nc3ccccc3Oc3ncccc32)cc1.
What is the InChIKey of N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide?
The InChIKey is HZZYVGQOQIFIBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N3O3/c23-18(22-24)13-9-7-12(8-10-13)17-14-4-3-11-20-19(14)25-16-6-2-1-5-15(16)21-17/h1-11,24H,(H,22,23).
What are the key properties of N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide?
N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide has a molecular weight of 331.33 g/mol, XLogP of 3.48, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-4-pyrido[2,3-b][1,5]benzoxazepin-5-ylbenzamide is sourced from PubChem (CID 25189456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).