C30H30N4O4S4 — CID 25189903
[2,6-bis(dicyanomethylidene)-8-(2-ethylhexanoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] 2-ethylhexanoate (PubChem CID 25189903) has the molecular formula C30H30N4O4S4 and a molecular weight of 638.86 g/mol. Its IUPAC name is [2,6-bis(dicyanomethylidene)-8-(2-ethylhexanoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] 2-ethylhexanoate.
| Compound Name | [2,6-bis(dicyanomethylidene)-8-(2-ethylhexanoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] 2-ethylhexanoate |
|---|---|
| PubChem CID | 25189903 |
| Molecular Formula | C30H30N4O4S4 |
| Molecular Weight | 638.86 g/mol |
| Exact Mass | 638.11 |
| IUPAC Name | [2,6-bis(dicyanomethylidene)-8-(2-ethylhexanoyloxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1c2c(c(OC(=O)C(CC)CCCC)c3c1SC(=C(C#N)C#N)S3)SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C30H30N4O4S4/c1-5-9-11-17(7-3)27(35)37-21-23-25(41-29(39-23)19(13-31)14-32)22(38-28(36)18(8-4)12-10-6-2)26-24(21)40-30(42-26)20(15-33)16-34/h17-18H,5-12H2,1-4H3 |
| InChIKey | PFQXJSDATOTAFU-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 147.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.86 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|