C30H34N4O2S4 — CID 25189904
2-[2-(dicyanomethylidene)-4,8-bis(2-ethylhexoxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]propanedinitrile (PubChem CID 25189904) has the molecular formula C30H34N4O2S4 and a molecular weight of 610.90 g/mol. Its IUPAC name is 2-[2-(dicyanomethylidene)-4,8-bis(2-ethylhexoxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]propanedinitrile.
| Compound Name | 2-[2-(dicyanomethylidene)-4,8-bis(2-ethylhexoxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 25189904 |
| Molecular Formula | C30H34N4O2S4 |
| Molecular Weight | 610.90 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | 2-[2-(dicyanomethylidene)-4,8-bis(2-ethylhexoxy)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-6-ylidene]propanedinitrile |
| SMILES | CCCCC(CC)COc1c2c(c(OCC(CC)CCCC)c3c1SC(=C(C#N)C#N)S3)SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C30H34N4O2S4/c1-5-9-11-19(7-3)17-35-23-25-27(39-29(37-25)21(13-31)14-32)24(36-18-20(8-4)12-10-6-2)28-26(23)38-30(40-28)22(15-33)16-34/h19-20H,5-12,17-18H2,1-4H3 |
| InChIKey | IDLBJBCKKCALTI-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.90 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|