C18H6N4O4S4 — CID 25189906
[8-acetyloxy-2,6-bis(dicyanomethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] acetate (PubChem CID 25189906) has the molecular formula C18H6N4O4S4 and a molecular weight of 470.54 g/mol. Its IUPAC name is [8-acetyloxy-2,6-bis(dicyanomethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] acetate.
| Compound Name | [8-acetyloxy-2,6-bis(dicyanomethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] acetate |
|---|---|
| PubChem CID | 25189906 |
| Molecular Formula | C18H6N4O4S4 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 469.93 |
| IUPAC Name | [8-acetyloxy-2,6-bis(dicyanomethylidene)-[1,3]dithiolo[4,5-f][1,3]benzodithiol-4-yl] acetate |
| SMILES | CC(=O)Oc1c2c(c(OC(C)=O)c3c1SC(=C(C#N)C#N)S3)SC(=C(C#N)C#N)S2 |
| InChI | InChI=1S/C18H6N4O4S4/c1-7(23)25-11-13-15(29-17(27-13)9(3-19)4-20)12(26-8(2)24)16-14(11)28-18(30-16)10(5-21)6-22/h1-2H3 |
| InChIKey | YQQQNPFTSLYBOP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 147.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|