C33H28F5NO4 — CID 25189957
13-cyclohexyl-3-methoxy-6-[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid (PubChem CID 25189957) has the molecular formula C33H28F5NO4 and a molecular weight of 597.58 g/mol. Its IUPAC name is 13-cyclohexyl-3-methoxy-6-[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid.
| Compound Name | 13-cyclohexyl-3-methoxy-6-[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid |
|---|---|
| PubChem CID | 25189957 |
| Molecular Formula | C33H28F5NO4 |
| Molecular Weight | 597.58 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | 13-cyclohexyl-3-methoxy-6-[2-(1,1,2,2,2-pentafluoroethoxy)phenyl]-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid |
| SMILES | COc1ccc2c(c1)C=C(c1ccccc1OC(F)(F)C(F)(F)F)Cn1c-2c(C2CCCCC2)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C33H28F5NO4/c1-42-23-12-14-25-21(16-23)15-22(24-9-5-6-10-28(24)43-33(37,38)32(34,35)36)18-39-27-17-20(31(40)41)11-13-26(27)29(30(25)39)19-7-3-2-4-8-19/h5-6,9-17,19H,2-4,7-8,18H2,1H3,(H,40,41) |
| InChIKey | MRGNHGKTWYPFMJ-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.58 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|